C28H34BrN5O6P+ — CID 153388850
[2-[[4-amino-8-[1-(2-bromoacetyl)-1-ethyl-2-methylaziridin-1-ium-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate (PubChem CID 153388850) has the molecular formula C28H34BrN5O6P+ and a molecular weight of 647.49 g/mol. Its IUPAC name is [2-[[4-amino-8-[1-(2-bromoacetyl)-1-ethyl-2-methylaziridin-1-ium-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-8-[1-(2-bromoacetyl)-1-ethyl-2-methylaziridin-1-ium-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 153388850 |
| Molecular Formula | C28H34BrN5O6P+ |
| Molecular Weight | 647.49 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | [2-[[4-amino-8-[1-(2-bromoacetyl)-1-ethyl-2-methylaziridin-1-ium-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3ccc(C4(C)C[N+]4(CC)C(=O)CBr)cc3c2n1Cc1cccc(O)c1OP(=O)(O)O |
| InChI | InChI=1S/C28H33BrN5O6P/c1-4-6-10-22-32-24-25(33(22)15-17-8-7-9-21(35)26(17)40-41(37,38)39)19-13-18(11-12-20(19)31-27(24)30)28(3)16-34(28,5-2)23(36)14-29/h7-9,11-13H,4-6,10,14-16H2,1-3H3,(H4-,30,31,35,37,38,39)/p+1 |
| InChIKey | VTVUSXLMNNGDKK-UHFFFAOYSA-O |
| XLogP | 4.72 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|