C26H30N5O7P — CID 157100243
[2-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate (PubChem CID 157100243) has the molecular formula C26H30N5O7P and a molecular weight of 555.53 g/mol. Its IUPAC name is [2-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 157100243 |
| Molecular Formula | C26H30N5O7P |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | [2-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(CCOCCN=C=O)ccc3c2n1Cc1cccc(O)c1OP(=O)(O)O |
| InChI | InChI=1S/C26H30N5O7P/c1-2-3-7-22-30-23-24(31(22)15-18-5-4-6-21(33)25(18)38-39(34,35)36)19-9-8-17(14-20(19)29-26(23)27)10-12-37-13-11-28-16-32/h4-6,8-9,14,33H,2-3,7,10-13,15H2,1H3,(H2,27,29)(H2,34,35,36) |
| InChIKey | OWXXUZCMCVYGOR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 182.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|