C27H33IN5O7P — CID 149489328
[3-[[4-amino-2-butyl-7-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate (PubChem CID 149489328) has the molecular formula C27H33IN5O7P and a molecular weight of 697.47 g/mol. Its IUPAC name is [3-[[4-amino-2-butyl-7-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[[4-amino-2-butyl-7-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 149489328 |
| Molecular Formula | C27H33IN5O7P |
| Molecular Weight | 697.47 g/mol |
| Exact Mass | 697.12 |
| IUPAC Name | [3-[[4-amino-2-butyl-7-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(CCOCCNC(=O)CI)ccc3c2n1Cc1cc(OP(=O)(O)O)ccc1O |
| InChI | InChI=1S/C27H33IN5O7P/c1-2-3-4-23-32-25-26(33(23)16-18-14-19(6-8-22(18)34)40-41(36,37)38)20-7-5-17(13-21(20)31-27(25)29)9-11-39-12-10-30-24(35)15-28/h5-8,13-14,34H,2-4,9-12,15-16H2,1H3,(H2,29,31)(H,30,35)(H2,36,37,38) |
| InChIKey | ZEUGISVYGJRIRO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|