C27H32IN5O4 — CID 160710706
N-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]-2-iodoacetamide (PubChem CID 160710706) has the molecular formula C27H32IN5O4 and a molecular weight of 617.49 g/mol. Its IUPAC name is N-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]-2-iodoacetamide.
| Compound Name | N-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 160710706 |
| Molecular Formula | C27H32IN5O4 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | N-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]-2-iodoacetamide |
| SMILES | CCCCc1nc2c(N)nc3ccc(CCOCCNC(=O)CI)cc3c2n1Cc1cc(O)ccc1O |
| InChI | InChI=1S/C27H32IN5O4/c1-2-3-4-23-32-25-26(33(23)16-18-14-19(34)6-8-22(18)35)20-13-17(5-7-21(20)31-27(25)29)9-11-37-12-10-30-24(36)15-28/h5-8,13-14,34-35H,2-4,9-12,15-16H2,1H3,(H2,29,31)(H,30,36) |
| InChIKey | UJBJUQMFSGISCU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|