C34H41N6O11P — CID 159405184
(2,5-dioxopyrrolidin-1-yl) 5-[2-[2-[4-amino-2-butyl-1-[(5-hydroxy-2-phosphonooxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethylamino]-5-oxopentanoate (PubChem CID 159405184) has the molecular formula C34H41N6O11P and a molecular weight of 740.71 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[2-[2-[4-amino-2-butyl-1-[(5-hydroxy-2-phosphonooxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethylamino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[2-[2-[4-amino-2-butyl-1-[(5-hydroxy-2-phosphonooxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 159405184 |
| Molecular Formula | C34H41N6O11P |
| Molecular Weight | 740.71 g/mol |
| Exact Mass | 740.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[2-[2-[4-amino-2-butyl-1-[(5-hydroxy-2-phosphonooxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethylamino]-5-oxopentanoate |
| SMILES | CCCCc1nc2c(N)nc3ccc(CCOCCNC(=O)CCCC(=O)ON4C(=O)CCC4=O)cc3c2n1Cc1cc(O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C34H41N6O11P/c1-2-3-5-27-38-32-33(39(27)20-22-19-23(41)9-11-26(22)51-52(46,47)48)24-18-21(8-10-25(24)37-34(32)35)14-16-49-17-15-36-28(42)6-4-7-31(45)50-40-29(43)12-13-30(40)44/h8-11,18-19,41H,2-7,12-17,20H2,1H3,(H2,35,37)(H,36,42)(H2,46,47,48) |
| InChIKey | SOOHQIQMHIARCT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 245.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|