C34H44N5O7P — CID 153389081
[3-[[4-amino-2-butyl-8-[2-methyl-4-[3-methyl-3-(prop-2-ynoylamino)butoxy]butan-2-yl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate (PubChem CID 153389081) has the molecular formula C34H44N5O7P and a molecular weight of 665.73 g/mol. Its IUPAC name is [3-[[4-amino-2-butyl-8-[2-methyl-4-[3-methyl-3-(prop-2-ynoylamino)butoxy]butan-2-yl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[[4-amino-2-butyl-8-[2-methyl-4-[3-methyl-3-(prop-2-ynoylamino)butoxy]butan-2-yl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 153389081 |
| Molecular Formula | C34H44N5O7P |
| Molecular Weight | 665.73 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | [3-[[4-amino-2-butyl-8-[2-methyl-4-[3-methyl-3-(prop-2-ynoylamino)butoxy]butan-2-yl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
| SMILES | C#CC(=O)NC(C)(C)CCOCCC(C)(C)c1ccc2nc(N)c3nc(CCCC)n(Cc4cc(OP(=O)(O)O)ccc4O)c3c2c1 |
| InChI | InChI=1S/C34H44N5O7P/c1-7-9-10-28-37-30-31(39(28)21-22-19-24(12-14-27(22)40)46-47(42,43)44)25-20-23(11-13-26(25)36-32(30)35)33(3,4)15-17-45-18-16-34(5,6)38-29(41)8-2/h2,11-14,19-20,40H,7,9-10,15-18,21H2,1,3-6H3,(H2,35,36)(H,38,41)(H2,42,43,44) |
| InChIKey | IKZBLBAYEVESSB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|