C16H20N4OS — CID 22320487
4-amino-2-methyl-1-(4-methylsulfanylbutyl)imidazo[4,5-c]quinolin-8-ol (PubChem CID 22320487) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-amino-2-methyl-1-(4-methylsulfanylbutyl)imidazo[4,5-c]quinolin-8-ol.
| Compound Name | 4-amino-2-methyl-1-(4-methylsulfanylbutyl)imidazo[4,5-c]quinolin-8-ol |
|---|---|
| PubChem CID | 22320487 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-amino-2-methyl-1-(4-methylsulfanylbutyl)imidazo[4,5-c]quinolin-8-ol |
| SMILES | CSCCCCn1c(C)nc2c(N)nc3ccc(O)cc3c21 |
| InChI | InChI=1S/C16H20N4OS/c1-10-18-14-15(20(10)7-3-4-8-22-2)12-9-11(21)5-6-13(12)19-16(14)17/h5-6,9,21H,3-4,7-8H2,1-2H3,(H2,17,19) |
| InChIKey | PEPRMBAZZBRRPH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|