C29H46N4O8S — CID 89115448
N-[2-[2-[2-[2-[3-[[4-(hydroxymethyl)phenyl]methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 89115448) has the molecular formula C29H46N4O8S and a molecular weight of 610.77 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[3-[[4-(hydroxymethyl)phenyl]methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[2-[2-[2-[3-[[4-(hydroxymethyl)phenyl]methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 89115448 |
| Molecular Formula | C29H46N4O8S |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | N-[2-[2-[2-[2-[3-[[4-(hydroxymethyl)phenyl]methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCOCCC(=O)NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C29H46N4O8S/c34-20-23-7-5-22(6-8-23)19-31-27(36)9-11-38-13-15-40-17-18-41-16-14-39-12-10-30-26(35)4-2-1-3-25-28-24(21-42-25)32-29(37)33-28/h5-8,24-25,28,34H,1-4,9-21H2,(H,30,35)(H,31,36)(H2,32,33,37) |
| InChIKey | VIWPILIIXRKUNP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|