C31H44N4O9S — CID 118656739
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[3-oxo-3-[(2-oxochromen-7-yl)methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 118656739) has the molecular formula C31H44N4O9S and a molecular weight of 648.78 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[3-oxo-3-[(2-oxochromen-7-yl)methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[3-oxo-3-[(2-oxochromen-7-yl)methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 118656739 |
| Molecular Formula | C31H44N4O9S |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[3-oxo-3-[(2-oxochromen-7-yl)methylamino]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCOCCC(=O)NCc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C31H44N4O9S/c36-27(4-2-1-3-26-30-24(21-45-26)34-31(39)35-30)32-10-12-41-14-16-43-18-17-42-15-13-40-11-9-28(37)33-20-22-5-6-23-7-8-29(38)44-25(23)19-22/h5-8,19,24,26,30H,1-4,9-18,20-21H2,(H,32,36)(H,33,37)(H2,34,35,39) |
| InChIKey | JTPNWHLQNPHVBT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 166.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|