C26H29N5O3S — CID 102352429
N-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl]acridine-9-carboxamide (PubChem CID 102352429) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl]acridine-9-carboxamide.
| Compound Name | N-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl]acridine-9-carboxamide |
|---|---|
| PubChem CID | 102352429 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl]acridine-9-carboxamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCNC(=O)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C26H29N5O3S/c32-22(12-6-5-11-21-24-20(15-35-21)30-26(34)31-24)27-13-14-28-25(33)23-16-7-1-3-9-18(16)29-19-10-4-2-8-17(19)23/h1-4,7-10,20-21,24H,5-6,11-15H2,(H,27,32)(H,28,33)(H2,30,31,34) |
| InChIKey | JJVJZQJYJSNQJW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|