C34H46N4O7S — CID 124786997
N-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-4-benzoylbenzamide (PubChem CID 124786997) has the molecular formula C34H46N4O7S and a molecular weight of 654.83 g/mol. Its IUPAC name is N-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-4-benzoylbenzamide.
| Compound Name | N-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-4-benzoylbenzamide |
|---|---|
| PubChem CID | 124786997 |
| Molecular Formula | C34H46N4O7S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | N-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-4-benzoylbenzamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCCOCCOCCOCCCNC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H46N4O7S/c39-30(11-5-4-10-29-31-28(24-46-29)37-34(42)38-31)35-16-6-18-43-20-22-45-23-21-44-19-7-17-36-33(41)27-14-12-26(13-15-27)32(40)25-8-2-1-3-9-25/h1-3,8-9,12-15,28-29,31H,4-7,10-11,16-24H2,(H,35,39)(H,36,41)(H2,37,38,42)/t28-,29-,31-/m0/s1 |
| InChIKey | HCJSAUXAUBGYDL-QMOZSOIISA-N |
| XLogP | 3.32 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|