C25H37N7O6S — CID 135356082
4-azido-N-[2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 135356082) has the molecular formula C25H37N7O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is 4-azido-N-[2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-azido-N-[2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 135356082 |
| Molecular Formula | C25H37N7O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 4-azido-N-[2-[2-[2-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCCOCCOCCOCCNC(=O)CCCCC2SCC3NC(=O)NC32)cc1 |
| InChI | InChI=1S/C25H37N7O6S/c26-32-31-19-7-5-18(6-8-19)24(34)28-10-12-37-14-16-38-15-13-36-11-9-27-22(33)4-2-1-3-21-23-20(17-39-21)29-25(35)30-23/h5-8,20-21,23H,1-4,9-17H2,(H,27,33)(H,28,34)(H2,29,30,35) |
| InChIKey | UJIFRKNSADYDEM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 175.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|