C24H27N3O4S — CID 154725902
[2-[(2-phenylacetyl)amino]phenyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 154725902) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is [2-[(2-phenylacetyl)amino]phenyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [2-[(2-phenylacetyl)amino]phenyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 154725902 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | [2-[(2-phenylacetyl)amino]phenyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C(Cc1ccccc1)Nc1ccccc1OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C24H27N3O4S/c28-21(14-16-8-2-1-3-9-16)25-17-10-4-5-11-19(17)31-22(29)13-7-6-12-20-23-18(15-32-20)26-24(30)27-23/h1-5,8-11,18,20,23H,6-7,12-15H2,(H,25,28)(H2,26,27,30)/t18-,20-,23-/m0/s1 |
| InChIKey | OTEYVUKVTPAVKH-LEDOBFOHSA-N |
| XLogP | 3.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|