C17H22N2O2S2 — CID 58572222
4-[5-oxo-6-(4-sulfanylphenyl)hexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 58572222) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-[5-oxo-6-(4-sulfanylphenyl)hexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[5-oxo-6-(4-sulfanylphenyl)hexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 58572222 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[5-oxo-6-(4-sulfanylphenyl)hexyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)Cc1ccc(S)cc1 |
| InChI | InChI=1S/C17H22N2O2S2/c20-12(9-11-5-7-13(22)8-6-11)3-1-2-4-15-16-14(10-23-15)18-17(21)19-16/h5-8,14-16,22H,1-4,9-10H2,(H2,18,19,21) |
| InChIKey | SICHRIUQJINVMZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|