C19H24N4O7S — CID 87275103
(2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]phenyl]-2-nitramidopropanoic acid (PubChem CID 87275103) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]phenyl]-2-nitramidopropanoic acid.
| Compound Name | (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]phenyl]-2-nitramidopropanoic acid |
|---|---|
| PubChem CID | 87275103 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]phenyl]-2-nitramidopropanoic acid |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)Oc2ccc(C[C@H](N[N+](=O)[O-])C(=O)O)cc2)N1 |
| InChI | InChI=1S/C19H24N4O7S/c24-16(4-2-1-3-15-17-14(10-31-15)20-19(27)21-17)30-12-7-5-11(6-8-12)9-13(18(25)26)22-23(28)29/h5-8,13-15,17,22H,1-4,9-10H2,(H,25,26)(H2,20,21,27)/t13-,14-,15-,17-/m0/s1 |
| InChIKey | NJOHVBMPHHGSNB-JKQORVJESA-N |
| XLogP | 1.09 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|