C19H26N4O4S — CID 140875980
(2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]phenyl]-2-hydrazinylpropanoic acid (PubChem CID 140875980) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]phenyl]-2-hydrazinylpropanoic acid.
| Compound Name | (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]phenyl]-2-hydrazinylpropanoic acid |
|---|---|
| PubChem CID | 140875980 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2S)-3-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]phenyl]-2-hydrazinylpropanoic acid |
| SMILES | NN[C@@H](Cc1ccc(C(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1)C(=O)O |
| InChI | InChI=1S/C19H26N4O4S/c20-23-13(18(25)26)9-11-5-7-12(8-6-11)15(24)3-1-2-4-16-17-14(10-28-16)21-19(27)22-17/h5-8,13-14,16-17,23H,1-4,9-10,20H2,(H,25,26)(H2,21,22,27)/t13-,14-,16-,17-/m0/s1 |
| InChIKey | HHPASOUNTNMMPG-OTRWWLKZSA-N |
| XLogP | 1.05 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|