C15H23N5O2S — CID 58481229
4-[7-(1-methyltriazol-4-yl)-5-oxoheptyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 58481229) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[7-(1-methyltriazol-4-yl)-5-oxoheptyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[7-(1-methyltriazol-4-yl)-5-oxoheptyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 58481229 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[7-(1-methyltriazol-4-yl)-5-oxoheptyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | Cn1cc(CCC(=O)CCCCC2SCC3NC(=O)NC32)nn1 |
| InChI | InChI=1S/C15H23N5O2S/c1-20-8-10(18-19-20)6-7-11(21)4-2-3-5-13-14-12(9-23-13)16-15(22)17-14/h8,12-14H,2-7,9H2,1H3,(H2,16,17,22) |
| InChIKey | SQQIXUBYNQEYNC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|