C31H50BrN5O8S — CID 58481319
5-O-tert-butyl 1-O-[2-[2-[2-[4-[3-oxo-7-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)heptyl]triazol-1-yl]ethoxy]ethoxy]ethyl] 4-bromo-2,2-dimethylpentanedioate (PubChem CID 58481319) has the molecular formula C31H50BrN5O8S and a molecular weight of 732.74 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[2-[2-[2-[4-[3-oxo-7-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)heptyl]triazol-1-yl]ethoxy]ethoxy]ethyl] 4-bromo-2,2-dimethylpentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[2-[2-[2-[4-[3-oxo-7-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)heptyl]triazol-1-yl]ethoxy]ethoxy]ethyl] 4-bromo-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 58481319 |
| Molecular Formula | C31H50BrN5O8S |
| Molecular Weight | 732.74 g/mol |
| Exact Mass | 731.26 |
| IUPAC Name | 5-O-tert-butyl 1-O-[2-[2-[2-[4-[3-oxo-7-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)heptyl]triazol-1-yl]ethoxy]ethoxy]ethyl] 4-bromo-2,2-dimethylpentanedioate |
| SMILES | CC(C)(C)OC(=O)C(Br)CC(C)(C)C(=O)OCCOCCOCCn1cc(CCC(=O)CCCCC2SCC3NC(=O)NC32)nn1 |
| InChI | InChI=1S/C31H50BrN5O8S/c1-30(2,3)45-27(39)23(32)18-31(4,5)28(40)44-17-16-43-15-14-42-13-12-37-19-21(35-36-37)10-11-22(38)8-6-7-9-25-26-24(20-46-25)33-29(41)34-26/h19,23-26H,6-18,20H2,1-5H3,(H2,33,34,41) |
| InChIKey | YCXLMAYQNAOHTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 159.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|