C20H34N6O5S — CID 170541204
5-[(3aR,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-methoxy-N-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 170541204) has the molecular formula C20H34N6O5S and a molecular weight of 470.60 g/mol. Its IUPAC name is 5-[(3aR,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-methoxy-N-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-[(3aR,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-methoxy-N-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 170541204 |
| Molecular Formula | C20H34N6O5S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 5-[(3aR,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-methoxy-N-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CON(CCOCCOCCn1cc(C)nn1)C(=O)CCCCC1SC[C@H]2NC(=O)N[C@@H]12 |
| InChI | InChI=1S/C20H34N6O5S/c1-15-13-25(24-23-15)7-9-30-11-12-31-10-8-26(29-2)18(27)6-4-3-5-17-19-16(14-32-17)21-20(28)22-19/h13,16-17,19H,3-12,14H2,1-2H3,(H2,21,22,28)/t16-,17?,19-/m1/s1 |
| InChIKey | SZDUUPZFBOROJZ-IRQCGSAXSA-N |
| XLogP | 0.74 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|