C30H50N6O8S — CID 158271040
(2R)-7-[1-[2-[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]-2-(2-aminoethyl)-4-oxoheptanoic acid (PubChem CID 158271040) has the molecular formula C30H50N6O8S and a molecular weight of 654.83 g/mol. Its IUPAC name is (2R)-7-[1-[2-[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]-2-(2-aminoethyl)-4-oxoheptanoic acid.
| Compound Name | (2R)-7-[1-[2-[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]-2-(2-aminoethyl)-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 158271040 |
| Molecular Formula | C30H50N6O8S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | (2R)-7-[1-[2-[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]-2-(2-aminoethyl)-4-oxoheptanoic acid |
| SMILES | NCCC(CC(=O)CCCc1cn(CCOCCOCCOCCCC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)nn1)C(=O)O |
| InChI | InChI=1S/C30H50N6O8S/c31-11-10-22(29(39)40)19-25(38)7-3-5-23-20-36(35-34-23)12-14-43-16-18-44-17-15-42-13-4-8-24(37)6-1-2-9-27-28-26(21-45-27)32-30(41)33-28/h20,22,26-28H,1-19,21,31H2,(H,39,40)(H2,32,33,41)/t22?,26-,27-,28-/m0/s1 |
| InChIKey | GJAKTXYWMZPVED-LDZCGHGOSA-N |
| XLogP | 1.73 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|