C16H28N3O4PS2 — CID 139481629
5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[ethenyl(ethoxy)phosphoryl]sulfanylethyl]pentanamide (PubChem CID 139481629) has the molecular formula C16H28N3O4PS2 and a molecular weight of 421.53 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[ethenyl(ethoxy)phosphoryl]sulfanylethyl]pentanamide.
| Compound Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[ethenyl(ethoxy)phosphoryl]sulfanylethyl]pentanamide |
|---|---|
| PubChem CID | 139481629 |
| Molecular Formula | C16H28N3O4PS2 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[ethenyl(ethoxy)phosphoryl]sulfanylethyl]pentanamide |
| SMILES | C=CP(=O)(OCC)SCCNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C16H28N3O4PS2/c1-3-23-24(22,4-2)26-10-9-17-14(20)8-6-5-7-13-15-12(11-25-13)18-16(21)19-15/h4,12-13,15H,2-3,5-11H2,1H3,(H,17,20)(H2,18,19,21)/t12-,13-,15-,24?/m1/s1 |
| InChIKey | PDPGRAKOYCAJRL-NEVMSSNBSA-N |
| XLogP | 2.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|