C33H54N4O10S — CID 172572044
4-[3-[[2-[2-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]ethoxy]ethylamino]methyl]-4-methoxyphenoxy]butanoic acid (PubChem CID 172572044) has the molecular formula C33H54N4O10S and a molecular weight of 698.88 g/mol. Its IUPAC name is 4-[3-[[2-[2-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]ethoxy]ethylamino]methyl]-4-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[3-[[2-[2-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]ethoxy]ethylamino]methyl]-4-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 172572044 |
| Molecular Formula | C33H54N4O10S |
| Molecular Weight | 698.88 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | 4-[3-[[2-[2-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]ethoxy]ethylamino]methyl]-4-methoxyphenoxy]butanoic acid |
| SMILES | COc1ccc(OCCCC(=O)O)cc1CNCCOCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C33H54N4O10S/c1-42-28-10-9-26(47-14-4-8-31(39)40)22-25(28)23-34-12-15-44-17-19-46-21-20-45-18-16-43-13-5-11-35-30(38)7-3-2-6-29-32-27(24-48-29)36-33(41)37-32/h9-10,22,27,29,32,34H,2-8,11-21,23-24H2,1H3,(H,35,38)(H,39,40)(H2,36,37,41)/t27-,29-,32-/m0/s1 |
| InChIKey | CBXQEJXJHZECQU-HYPZGNBFSA-N |
| XLogP | 2.33 |
| TPSA | 174.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|