C23H32ClN3O7S — CID 163273806
(3-chloro-4-methoxyphenyl) 2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]acetate (PubChem CID 163273806) has the molecular formula C23H32ClN3O7S and a molecular weight of 530.04 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl) 2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]acetate.
| Compound Name | (3-chloro-4-methoxyphenyl) 2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 163273806 |
| Molecular Formula | C23H32ClN3O7S |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | (3-chloro-4-methoxyphenyl) 2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]acetate |
| SMILES | COc1ccc(OC(=O)COCCOCCNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1Cl |
| InChI | InChI=1S/C23H32ClN3O7S/c1-31-18-7-6-15(12-16(18)24)34-21(29)13-33-11-10-32-9-8-25-20(28)5-3-2-4-19-22-17(14-35-19)26-23(30)27-22/h6-7,12,17,19,22H,2-5,8-11,13-14H2,1H3,(H,25,28)(H2,26,27,30)/t17-,19-,22-/m0/s1 |
| InChIKey | MTSXPFQYVURDDV-JLMWRMLUSA-N |
| XLogP | 2.13 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|