C33H59N5O12 — CID 178022663
2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethanamine;ethane;prop-2-enyl 2-[1-[5-methoxy-2-nitro-4-(4-oxobutoxy)phenyl]ethoxycarbonylamino]-5-(methylamino)pentanoate (PubChem CID 178022663) has the molecular formula C33H59N5O12 and a molecular weight of 717.86 g/mol. Its IUPAC name is 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethanamine;ethane;prop-2-enyl 2-[1-[5-methoxy-2-nitro-4-(4-oxobutoxy)phenyl]ethoxycarbonylamino]-5-(methylamino)pentanoate.
| Compound Name | 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethanamine;ethane;prop-2-enyl 2-[1-[5-methoxy-2-nitro-4-(4-oxobutoxy)phenyl]ethoxycarbonylamino]-5-(methylamino)pentanoate |
|---|---|
| PubChem CID | 178022663 |
| Molecular Formula | C33H59N5O12 |
| Molecular Weight | 717.86 g/mol |
| Exact Mass | 717.42 |
| IUPAC Name | 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethanamine;ethane;prop-2-enyl 2-[1-[5-methoxy-2-nitro-4-(4-oxobutoxy)phenyl]ethoxycarbonylamino]-5-(methylamino)pentanoate |
| SMILES | C=CCOC(=O)C(CCCNC)NC(=O)OC(C)c1cc(OC)c(OCCCC=O)cc1[N+](=O)[O-].CC.NCCOCCOCCOCCN |
| InChI | InChI=1S/C23H33N3O9.C8H20N2O3.C2H6/c1-5-12-34-22(28)18(9-8-10-24-3)25-23(29)35-16(2)17-14-20(32-4)21(15-19(17)26(30)31)33-13-7-6-11-27;9-1-3-11-5-7-13-8-6-12-4-2-10;1-2/h5,11,14-16,18,24H,1,6-10,12-13H2,2-4H3,(H,25,29);1-10H2;1-2H3 |
| InChIKey | JRONVZFGKKATJH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 235.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|