C20H31N3O8S — CID 158177973
methyl 3-[[5-methoxy-4-[2-(methylamino)ethoxy]-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 158177973) has the molecular formula C20H31N3O8S and a molecular weight of 473.55 g/mol. Its IUPAC name is methyl 3-[[5-methoxy-4-[2-(methylamino)ethoxy]-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-[[5-methoxy-4-[2-(methylamino)ethoxy]-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 158177973 |
| Molecular Formula | C20H31N3O8S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl 3-[[5-methoxy-4-[2-(methylamino)ethoxy]-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CNCCOc1cc([N+](=O)[O-])c(CSCC(NC(=O)OC(C)(C)C)C(=O)OC)cc1OC |
| InChI | InChI=1S/C20H31N3O8S/c1-20(2,3)31-19(25)22-14(18(24)29-6)12-32-11-13-9-16(28-5)17(30-8-7-21-4)10-15(13)23(26)27/h9-10,14,21H,7-8,11-12H2,1-6H3,(H,22,25) |
| InChIKey | RKZZXXQXFHRNAG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|