C19H28N2O8 — CID 67775291
methyl (2S)-3-[4-[(2S)-1-methoxypropan-2-yl]oxy-2-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 67775291) has the molecular formula C19H28N2O8 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(2S)-1-methoxypropan-2-yl]oxy-2-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[4-[(2S)-1-methoxypropan-2-yl]oxy-2-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 67775291 |
| Molecular Formula | C19H28N2O8 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl (2S)-3-[4-[(2S)-1-methoxypropan-2-yl]oxy-2-nitrophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC[C@H](C)Oc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H28N2O8/c1-12(11-26-5)28-14-8-7-13(16(10-14)21(24)25)9-15(17(22)27-6)20-18(23)29-19(2,3)4/h7-8,10,12,15H,9,11H2,1-6H3,(H,20,23)/t12-,15-/m0/s1 |
| InChIKey | MYBWQPHDWWDDBU-WFASDCNBSA-N |
| XLogP | 2.62 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|