C23H36N4O9S — CID 154627413
methyl 3-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 154627413) has the molecular formula C23H36N4O9S and a molecular weight of 544.63 g/mol. Its IUPAC name is methyl 3-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 154627413 |
| Molecular Formula | C23H36N4O9S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | methyl 3-[[4-[4-(2-aminoethylamino)-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(CSCc1cc(OC)c(OCCCC(=O)NCCN)cc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N4O9S/c1-23(2,3)36-22(30)26-16(21(29)34-5)14-37-13-15-11-18(33-4)19(12-17(15)27(31)32)35-10-6-7-20(28)25-9-8-24/h11-12,16H,6-10,13-14,24H2,1-5H3,(H,25,28)(H,26,30) |
| InChIKey | RUDUQNIYACSOEC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|