C21H32N2O10S — CID 154627400
methyl 3-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 154627400) has the molecular formula C21H32N2O10S and a molecular weight of 504.56 g/mol. Its IUPAC name is methyl 3-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 154627400 |
| Molecular Formula | C21H32N2O10S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | methyl 3-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(CSCc1cc(OC)c(OCCOCCO)cc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O10S/c1-21(2,3)33-20(26)22-15(19(25)30-5)13-34-12-14-10-17(29-4)18(11-16(14)23(27)28)32-9-8-31-7-6-24/h10-11,15,24H,6-9,12-13H2,1-5H3,(H,22,26) |
| InChIKey | DMHSWELZMMGXEZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|