C19H24N2O8S — CID 58604713
prop-2-enyl 4-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanyl-3-nitrobenzoate (PubChem CID 58604713) has the molecular formula C19H24N2O8S and a molecular weight of 440.47 g/mol. Its IUPAC name is prop-2-enyl 4-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanyl-3-nitrobenzoate.
| Compound Name | prop-2-enyl 4-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 58604713 |
| Molecular Formula | C19H24N2O8S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | prop-2-enyl 4-[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]sulfanyl-3-nitrobenzoate |
| SMILES | C=CCOC(=O)c1ccc(SC[C@H](NC(=O)OC(C)(C)C)C(=O)OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N2O8S/c1-6-9-28-16(22)12-7-8-15(14(10-12)21(25)26)30-11-13(17(23)27-5)20-18(24)29-19(2,3)4/h6-8,10,13H,1,9,11H2,2-5H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | JBIPJHGFCPSPNW-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|