C16H19BrN2O8S — CID 174204038
3-(5-bromo-4-methoxycarbonyl-2-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 174204038) has the molecular formula C16H19BrN2O8S and a molecular weight of 479.31 g/mol. Its IUPAC name is 3-(5-bromo-4-methoxycarbonyl-2-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(5-bromo-4-methoxycarbonyl-2-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 174204038 |
| Molecular Formula | C16H19BrN2O8S |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 3-(5-bromo-4-methoxycarbonyl-2-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(SCC(NC(=O)OC(C)(C)C)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H19BrN2O8S/c1-16(2,3)27-15(23)18-10(13(20)21)7-28-12-6-9(17)8(14(22)26-4)5-11(12)19(24)25/h5-6,10H,7H2,1-4H3,(H,18,23)(H,20,21) |
| InChIKey | AONBRTHGLKXVCN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|