C16H19ClN2O7S — CID 175596028
3-(5-chloro-4-methoxycarbonyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid (PubChem CID 175596028) has the molecular formula C16H19ClN2O7S and a molecular weight of 418.86 g/mol. Its IUPAC name is 3-(5-chloro-4-methoxycarbonyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid.
| Compound Name | 3-(5-chloro-4-methoxycarbonyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid |
|---|---|
| PubChem CID | 175596028 |
| Molecular Formula | C16H19ClN2O7S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 3-(5-chloro-4-methoxycarbonyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(CC(NC(=O)OC(C)(C)C)C(=O)S)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O7S/c1-16(2,3)26-15(22)18-11(14(21)27)6-8-5-10(17)9(13(20)25-4)7-12(8)19(23)24/h5,7,11H,6H2,1-4H3,(H,18,22)(H,21,27) |
| InChIKey | INNOJNYZZZXZAA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|