C16H18N2O7S — CID 166124324
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(5-nitro-1-benzofuran-6-yl)sulfanyl]propanoic acid (PubChem CID 166124324) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(5-nitro-1-benzofuran-6-yl)sulfanyl]propanoic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(5-nitro-1-benzofuran-6-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166124324 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(5-nitro-1-benzofuran-6-yl)sulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSc1cc2occc2cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C16H18N2O7S/c1-16(2,3)25-15(21)17-10(14(19)20)8-26-13-7-12-9(4-5-24-12)6-11(13)18(22)23/h4-7,10H,8H2,1-3H3,(H,17,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | CRPPVOBEULYOAA-JTQLQIEISA-N |
| XLogP | 3.41 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|