C25H38N2O11S — CID 161110702
methyl 3-[[4-[4-[[4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]amino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-methylpropanoate (PubChem CID 161110702) has the molecular formula C25H38N2O11S and a molecular weight of 574.65 g/mol. Its IUPAC name is methyl 3-[[4-[4-[[4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]amino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-methylpropanoate.
| Compound Name | methyl 3-[[4-[4-[[4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]amino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 161110702 |
| Molecular Formula | C25H38N2O11S |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | methyl 3-[[4-[4-[[4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]amino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]methylsulfanyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CSCc1cc(OC)c(OCCCC(=O)NC2C(C)OC(CO)C(OC)C2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H38N2O11S/c1-14(25(31)36-5)12-39-13-16-9-18(34-3)19(10-17(16)27(32)33)37-8-6-7-21(29)26-22-15(2)38-20(11-28)24(35-4)23(22)30/h9-10,14-15,20,22-24,28,30H,6-8,11-13H2,1-5H3,(H,26,29) |
| InChIKey | ORXLLZINHHVIFE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 175.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|