C24H37N5O12 — CID 58966161
1-[4-(3-azidopropoxy)-5-methoxy-2-nitrophenyl]ethyl N-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate (PubChem CID 58966161) has the molecular formula C24H37N5O12 and a molecular weight of 587.58 g/mol. Its IUPAC name is 1-[4-(3-azidopropoxy)-5-methoxy-2-nitrophenyl]ethyl N-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate.
| Compound Name | 1-[4-(3-azidopropoxy)-5-methoxy-2-nitrophenyl]ethyl N-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate |
|---|---|
| PubChem CID | 58966161 |
| Molecular Formula | C24H37N5O12 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[4-(3-azidopropoxy)-5-methoxy-2-nitrophenyl]ethyl N-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate |
| SMILES | COc1cc(C(C)OC(=O)NCCCCCOC2OC(CO)C(O)C(O)C2O)c([N+](=O)[O-])cc1OCCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H37N5O12/c1-14(15-11-17(37-2)18(12-16(15)29(35)36)38-10-6-8-27-28-25)40-24(34)26-7-4-3-5-9-39-23-22(33)21(32)20(31)19(13-30)41-23/h11-12,14,19-23,30-33H,3-10,13H2,1-2H3,(H,26,34) |
| InChIKey | CSGYDILMELFGBH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 248.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|