C30H43NO6 — CID 6287287
1-(4,5-dimethoxy-2-nitrophenyl)ethyl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate (PubChem CID 6287287) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)ethyl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 6287287 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC(C)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H43NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(32)37-25(2)26-23-28(35-3)29(36-4)24-27(26)31(33)34/h9-10,12-13,15-16,18-19,23-25H,5-8,11,14,17,20-22H2,1-4H3/b10-9+,13-12+,16-15+,19-18+ |
| InChIKey | LIKGQASPYMHUMB-WFYBHXQRSA-N |
| XLogP | 8.36 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|