C18H28N2O6 — CID 175113640
tert-butyl N-[4-(1-butoxyethyl)-2-methoxy-5-nitrophenyl]carbamate (PubChem CID 175113640) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl N-[4-(1-butoxyethyl)-2-methoxy-5-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(1-butoxyethyl)-2-methoxy-5-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 175113640 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl N-[4-(1-butoxyethyl)-2-methoxy-5-nitrophenyl]carbamate |
| SMILES | CCCCOC(C)c1cc(OC)c(NC(=O)OC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N2O6/c1-7-8-9-25-12(2)13-10-16(24-6)14(11-15(13)20(22)23)19-17(21)26-18(3,4)5/h10-12H,7-9H2,1-6H3,(H,19,21) |
| InChIKey | KQVFOSBSDCUZCV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|