C36H53BrN4O12 — CID 161277164
tert-butyl N-(4-bromo-2-methoxy-5-nitrophenyl)carbamate;tert-butyl N-[4-(1-butoxyethenyl)-2-methoxy-5-nitrophenyl]carbamate;1-ethenoxybutane (PubChem CID 161277164) has the molecular formula C36H53BrN4O12 and a molecular weight of 813.74 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-2-methoxy-5-nitrophenyl)carbamate;tert-butyl N-[4-(1-butoxyethenyl)-2-methoxy-5-nitrophenyl]carbamate;1-ethenoxybutane.
| Compound Name | tert-butyl N-(4-bromo-2-methoxy-5-nitrophenyl)carbamate;tert-butyl N-[4-(1-butoxyethenyl)-2-methoxy-5-nitrophenyl]carbamate;1-ethenoxybutane |
|---|---|
| PubChem CID | 161277164 |
| Molecular Formula | C36H53BrN4O12 |
| Molecular Weight | 813.74 g/mol |
| Exact Mass | 812.28 |
| IUPAC Name | tert-butyl N-(4-bromo-2-methoxy-5-nitrophenyl)carbamate;tert-butyl N-[4-(1-butoxyethenyl)-2-methoxy-5-nitrophenyl]carbamate;1-ethenoxybutane |
| SMILES | C=C(OCCCC)c1cc(OC)c(NC(=O)OC(C)(C)C)cc1[N+](=O)[O-].C=COCCCC.COc1cc(Br)c([N+](=O)[O-])cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O6.C12H15BrN2O5.C6H12O/c1-7-8-9-25-12(2)13-10-16(24-6)14(11-15(13)20(22)23)19-17(21)26-18(3,4)5;1-12(2,3)20-11(16)14-8-6-9(15(17)18)7(13)5-10(8)19-4;1-3-5-6-7-4-2/h10-11H,2,7-9H2,1,3-6H3,(H,19,21);5-6H,1-4H3,(H,14,16);4H,2-3,5-6H2,1H3 |
| InChIKey | VEOYCAJRVGYMKD-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 199.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.74 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|