C14H16N4O6 — CID 139213602
1-[5-methoxy-2-nitro-4-(2H-triazol-4-ylmethoxy)phenyl]ethyl acetate (PubChem CID 139213602) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 1-[5-methoxy-2-nitro-4-(2H-triazol-4-ylmethoxy)phenyl]ethyl acetate.
| Compound Name | 1-[5-methoxy-2-nitro-4-(2H-triazol-4-ylmethoxy)phenyl]ethyl acetate |
|---|---|
| PubChem CID | 139213602 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[5-methoxy-2-nitro-4-(2H-triazol-4-ylmethoxy)phenyl]ethyl acetate |
| SMILES | COc1cc(C(C)OC(C)=O)c([N+](=O)[O-])cc1OCc1cn[nH]n1 |
| InChI | InChI=1S/C14H16N4O6/c1-8(24-9(2)19)11-4-13(22-3)14(5-12(11)18(20)21)23-7-10-6-15-17-16-10/h4-6,8H,7H2,1-3H3,(H,15,16,17) |
| InChIKey | VMAUSFZASDMBGO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|