C25H37N7O9 — CID 87830343
(2S)-2-[acetyl-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-6-(2,4-dinitroanilino)hexanoic acid (PubChem CID 87830343) has the molecular formula C25H37N7O9 and a molecular weight of 579.61 g/mol. Its IUPAC name is (2S)-2-[acetyl-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-6-(2,4-dinitroanilino)hexanoic acid.
| Compound Name | (2S)-2-[acetyl-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-6-(2,4-dinitroanilino)hexanoic acid |
|---|---|
| PubChem CID | 87830343 |
| Molecular Formula | C25H37N7O9 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | (2S)-2-[acetyl-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]amino]-6-(2,4-dinitroanilino)hexanoic acid |
| SMILES | CC(=O)N(C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN)[C@@H](CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C25H37N7O9/c1-16(33)30(24(35)20-9-6-14-29(20)23(34)18(27)7-2-4-12-26)21(25(36)37)8-3-5-13-28-19-11-10-17(31(38)39)15-22(19)32(40)41/h10-11,15,18,20-21,28H,2-9,12-14,26-27H2,1H3,(H,36,37)/t18-,20-,21-/m0/s1 |
| InChIKey | BSQIBHKUWDXEQJ-JBACZVJFSA-N |
| XLogP | 1.36 |
| TPSA | 245.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|