C32H35N5O13 — CID 89396302
(2S)-1-[(2S)-2-[[(1S)-1-carboxy-5-(2,4-dinitroanilino)pentyl]-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 89396302) has the molecular formula C32H35N5O13 and a molecular weight of 697.65 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(1S)-1-carboxy-5-(2,4-dinitroanilino)pentyl]-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-5-(2,4-dinitroanilino)pentyl]-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 89396302 |
| Molecular Formula | C32H35N5O13 |
| Molecular Weight | 697.65 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-5-(2,4-dinitroanilino)pentyl]-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc2c(CC(=O)N([C@@H](C)C(=O)N3CCC[C@H]3C(=O)O)[C@@H](CCCCNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C(=O)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C32H35N5O13/c1-18(30(40)34-13-5-7-24(34)31(41)42)35(28(38)14-19-15-29(39)50-27-17-21(49-2)9-10-22(19)27)25(32(43)44)6-3-4-12-33-23-11-8-20(36(45)46)16-26(23)37(47)48/h8-11,15-18,24-25,33H,3-7,12-14H2,1-2H3,(H,41,42)(H,43,44)/t18-,24-,25-/m0/s1 |
| InChIKey | GSVRSSLZNMMSNR-WDNCENIBSA-N |
| XLogP | 3.19 |
| TPSA | 252.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|