C21H30N4O8 — CID 122417373
N-[6-(2,4-dinitroanilino)hexyl]-2-[2-methyl-4-oxo-2-(2-oxoethyl)butoxy]acetamide (PubChem CID 122417373) has the molecular formula C21H30N4O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-[6-(2,4-dinitroanilino)hexyl]-2-[2-methyl-4-oxo-2-(2-oxoethyl)butoxy]acetamide.
| Compound Name | N-[6-(2,4-dinitroanilino)hexyl]-2-[2-methyl-4-oxo-2-(2-oxoethyl)butoxy]acetamide |
|---|---|
| PubChem CID | 122417373 |
| Molecular Formula | C21H30N4O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[6-(2,4-dinitroanilino)hexyl]-2-[2-methyl-4-oxo-2-(2-oxoethyl)butoxy]acetamide |
| SMILES | CC(CC=O)(CC=O)COCC(=O)NCCCCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30N4O8/c1-21(8-12-26,9-13-27)16-33-15-20(28)23-11-5-3-2-4-10-22-18-7-6-17(24(29)30)14-19(18)25(31)32/h6-7,12-14,22H,2-5,8-11,15-16H2,1H3,(H,23,28) |
| InChIKey | LLLZBPBQXCYBAX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|