C19H15Cl2N5O4 — CID 133283041
2-chloro-N-[2-[[5-chloro-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]amino]ethyl]benzamide (PubChem CID 133283041) has the molecular formula C19H15Cl2N5O4 and a molecular weight of 448.27 g/mol. Its IUPAC name is 2-chloro-N-[2-[[5-chloro-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[5-chloro-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133283041 |
| Molecular Formula | C19H15Cl2N5O4 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2-chloro-N-[2-[[5-chloro-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1cnn(-c2ccc([N+](=O)[O-])cc2)c(=O)c1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C19H15Cl2N5O4/c20-15-4-2-1-3-14(15)18(27)23-10-9-22-16-11-24-25(19(28)17(16)21)12-5-7-13(8-6-12)26(29)30/h1-8,11,22H,9-10H2,(H,23,27) |
| InChIKey | GHJOZKINTGGJAI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|