C20H16ClN5O4 — CID 133285027
4-chloro-5-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133285027) has the molecular formula C20H16ClN5O4 and a molecular weight of 425.83 g/mol. Its IUPAC name is 4-chloro-5-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133285027 |
| Molecular Formula | C20H16ClN5O4 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 4-chloro-5-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=C(CNc1cnn(-c2ccc([N+](=O)[O-])cc2)c(=O)c1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H16ClN5O4/c21-19-16(22-12-18(27)24-10-9-13-3-1-2-4-17(13)24)11-23-25(20(19)28)14-5-7-15(8-6-14)26(29)30/h1-8,11,22H,9-10,12H2 |
| InChIKey | QDVMNJOTOOBUQB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|