C18H15ClN4O5 — CID 133448216
4-chloro-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133448216) has the molecular formula C18H15ClN4O5 and a molecular weight of 402.79 g/mol. Its IUPAC name is 4-chloro-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133448216 |
| Molecular Formula | C18H15ClN4O5 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-chloro-5-[(2-hydroxy-3-methoxyphenyl)methylamino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | COc1cccc(CNc2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)c1O |
| InChI | InChI=1S/C18H15ClN4O5/c1-28-15-4-2-3-11(17(15)24)9-20-14-10-21-22(18(25)16(14)19)12-5-7-13(8-6-12)23(26)27/h2-8,10,20,24H,9H2,1H3 |
| InChIKey | YRJNINDLGLKFCF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|