C17H14FN5O2 — CID 133432489
6-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitroimidazo[1,2-b]pyridazine (PubChem CID 133432489) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitroimidazo[1,2-b]pyridazine.
| Compound Name | 6-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitroimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 133432489 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitroimidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CC=C(c4ccc(F)cc4)CC3)nn12 |
| InChI | InChI=1S/C17H14FN5O2/c18-14-3-1-12(2-4-14)13-7-9-21(10-8-13)16-6-5-15-19-11-17(23(24)25)22(15)20-16/h1-7,11H,8-10H2 |
| InChIKey | GHWZEEHEYZBGTJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|