C15H14N6O3 — CID 133420016
3-nitro-6-(3-pyridin-4-yloxypyrrolidin-1-yl)imidazo[1,2-b]pyridazine (PubChem CID 133420016) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is 3-nitro-6-(3-pyridin-4-yloxypyrrolidin-1-yl)imidazo[1,2-b]pyridazine.
| Compound Name | 3-nitro-6-(3-pyridin-4-yloxypyrrolidin-1-yl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 133420016 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-nitro-6-(3-pyridin-4-yloxypyrrolidin-1-yl)imidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2ccc(N3CCC(Oc4ccncc4)C3)nn12 |
| InChI | InChI=1S/C15H14N6O3/c22-21(23)15-9-17-13-1-2-14(18-20(13)15)19-8-5-12(10-19)24-11-3-6-16-7-4-11/h1-4,6-7,9,12H,5,8,10H2 |
| InChIKey | JVVHTSGZZYRPFB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|