C13H16N6O4 — CID 133447554
1-morpholin-4-yl-2-[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-one (PubChem CID 133447554) has the molecular formula C13H16N6O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-one.
| Compound Name | 1-morpholin-4-yl-2-[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-one |
|---|---|
| PubChem CID | 133447554 |
| Molecular Formula | C13H16N6O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-morpholin-4-yl-2-[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-one |
| SMILES | CC(Nc1ccc2ncc([N+](=O)[O-])n2n1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H16N6O4/c1-9(13(20)17-4-6-23-7-5-17)15-10-2-3-11-14-8-12(19(21)22)18(11)16-10/h2-3,8-9H,4-7H2,1H3,(H,15,16) |
| InChIKey | LVHUVKCDJAVQOR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|