C12H17ClN4O2 — CID 112689350
2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-morpholin-4-ylpropan-1-one (PubChem CID 112689350) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 112689350 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1nc(Cl)cc(NC(C)C(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C12H17ClN4O2/c1-8(12(18)17-3-5-19-6-4-17)14-11-7-10(13)15-9(2)16-11/h7-8H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | AQYCMSUASXMAKG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |