About 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one
2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one (PubChem CID 112749321) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one |
| PubChem CID | 112749321 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(NC1=NCCN1C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H20N4O2/c1-9(13-11-12-3-4-14(11)2)10(16)15-5-7-17-8-6-15/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | QIUIFQWNFYCOQA-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one?
The IUPAC name of 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one (CID 112749321) is 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one?
The canonical SMILES for 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one is CC(NC1=NCCN1C)C(=O)N1CCOCC1.
What is the InChIKey of 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one?
The InChIKey is QIUIFQWNFYCOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-9(13-11-12-3-4-14(11)2)10(16)15-5-7-17-8-6-15/h9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one?
2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one has a molecular weight of 240.31 g/mol, XLogP of -0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]-1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 112749321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).