C13H15Cl2FN2O2 — CID 103579849
2-(3,5-dichloro-4-fluoroanilino)-1-morpholin-4-ylpropan-1-one (PubChem CID 103579849) has the molecular formula C13H15Cl2FN2O2 and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluoroanilino)-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-(3,5-dichloro-4-fluoroanilino)-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 103579849 |
| Molecular Formula | C13H15Cl2FN2O2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-(3,5-dichloro-4-fluoroanilino)-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(Nc1cc(Cl)c(F)c(Cl)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H15Cl2FN2O2/c1-8(13(19)18-2-4-20-5-3-18)17-9-6-10(14)12(16)11(15)7-9/h6-8,17H,2-5H2,1H3 |
| InChIKey | GEEZZWCFPPIDRU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|